C8H7F6N3OS — CID 538728
N-[1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-ylamino)propan-2-yl]acetamide (PubChem CID 538728) has the molecular formula C8H7F6N3OS and a molecular weight of 307.22 g/mol. Its IUPAC name is N-[1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-ylamino)propan-2-yl]acetamide.
| Compound Name | N-[1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-ylamino)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 538728 |
| Molecular Formula | C8H7F6N3OS |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | N-[1,1,1,3,3,3-hexafluoro-2-(1,3-thiazol-2-ylamino)propan-2-yl]acetamide |
| SMILES | CC(=O)NC(Nc1nccs1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H7F6N3OS/c1-4(18)16-6(7(9,10)11,8(12,13)14)17-5-15-2-3-19-5/h2-3H,1H3,(H,15,17)(H,16,18) |
| InChIKey | DESBXVSHODGKMS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|