C20H16N4O5 — CID 5387446
(5Z)-4-(1,3-benzoxazol-2-yl)-1-(2-ethoxyphenyl)-5-hydrazinylidenepiperidine-2,3,6-trione (PubChem CID 5387446) has the molecular formula C20H16N4O5 and a molecular weight of 392.37 g/mol. Its IUPAC name is (5Z)-4-(1,3-benzoxazol-2-yl)-1-(2-ethoxyphenyl)-5-hydrazinylidenepiperidine-2,3,6-trione.
| Compound Name | (5Z)-4-(1,3-benzoxazol-2-yl)-1-(2-ethoxyphenyl)-5-hydrazinylidenepiperidine-2,3,6-trione |
|---|---|
| PubChem CID | 5387446 |
| Molecular Formula | C20H16N4O5 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | (5Z)-4-(1,3-benzoxazol-2-yl)-1-(2-ethoxyphenyl)-5-hydrazinylidenepiperidine-2,3,6-trione |
| SMILES | CCOc1ccccc1N1C(=O)C(=O)C(c2nc3ccccc3o2)/C(=N/N)C1=O |
| InChI | InChI=1S/C20H16N4O5/c1-2-28-14-10-6-4-8-12(14)24-19(26)16(23-21)15(17(25)20(24)27)18-22-11-7-3-5-9-13(11)29-18/h3-10,15H,2,21H2,1H3/b23-16- |
| InChIKey | ZLOAMEJSBQWINK-KQWNVCNZSA-N |
| XLogP | 1.77 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|