About 2-methylpentan-3-yl acetate
2-methylpentan-3-yl acetate (PubChem CID 538750) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 2-methylpentan-3-yl acetate.
Molecular Properties
| Compound Name | 2-methylpentan-3-yl acetate |
| PubChem CID | 538750 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 2-methylpentan-3-yl acetate |
| SMILES | CCC(OC(C)=O)C(C)C |
| InChI | InChI=1S/C8H16O2/c1-5-8(6(2)3)10-7(4)9/h6,8H,5H2,1-4H3 |
| InChIKey | GLESBSXIWORDRL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpentan-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentan-3-yl acetate?
The IUPAC name of 2-methylpentan-3-yl acetate (CID 538750) is 2-methylpentan-3-yl acetate.
What is the SMILES notation for 2-methylpentan-3-yl acetate?
The canonical SMILES for 2-methylpentan-3-yl acetate is CCC(OC(C)=O)C(C)C.
What is the InChIKey of 2-methylpentan-3-yl acetate?
The InChIKey is GLESBSXIWORDRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-5-8(6(2)3)10-7(4)9/h6,8H,5H2,1-4H3.
What are the key properties of 2-methylpentan-3-yl acetate?
2-methylpentan-3-yl acetate has a molecular weight of 144.21 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentan-3-yl acetate is sourced from PubChem (CID 538750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).