C20H28O3 — CID 5387554
4-methoxy-2-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-2,3-dihydropyran-6-one (PubChem CID 5387554) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 4-methoxy-2-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-2,3-dihydropyran-6-one.
| Compound Name | 4-methoxy-2-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 5387554 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 4-methoxy-2-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]-2,3-dihydropyran-6-one |
| SMILES | COC1=CC(=O)OC(/C=C(C)/C=C/C2=C(C)CCCC2(C)C)C1 |
| InChI | InChI=1S/C20H28O3/c1-14(11-17-12-16(22-5)13-19(21)23-17)8-9-18-15(2)7-6-10-20(18,3)4/h8-9,11,13,17H,6-7,10,12H2,1-5H3/b9-8+,14-11+ |
| InChIKey | KWMXSAMVKSULMY-HUKVCQRGSA-N |
| XLogP | 4.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|