C23H33NO2 — CID 5387556
2-(2-methoxyethoxy)-4-methyl-6-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]pyridine (PubChem CID 5387556) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-4-methyl-6-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]pyridine.
| Compound Name | 2-(2-methoxyethoxy)-4-methyl-6-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]pyridine |
|---|---|
| PubChem CID | 5387556 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 2-(2-methoxyethoxy)-4-methyl-6-[(1E,3E)-2-methyl-4-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]pyridine |
| SMILES | COCCOc1cc(C)cc(/C=C(C)/C=C/C2=C(C)CCCC2(C)C)n1 |
| InChI | InChI=1S/C23H33NO2/c1-17(9-10-21-19(3)8-7-11-23(21,4)5)14-20-15-18(2)16-22(24-20)26-13-12-25-6/h9-10,14-16H,7-8,11-13H2,1-6H3/b10-9+,17-14+ |
| InChIKey | HNRHZJAVVSLQCH-XYJQQDCNSA-N |
| XLogP | 5.90 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|