C20H18O3 — CID 5387558
(4Z,6Z)-4,6-dibenzylidene-2,2-dimethyl-1,3-dioxan-5-one (PubChem CID 5387558) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is (4Z,6Z)-4,6-dibenzylidene-2,2-dimethyl-1,3-dioxan-5-one.
| Compound Name | (4Z,6Z)-4,6-dibenzylidene-2,2-dimethyl-1,3-dioxan-5-one |
|---|---|
| PubChem CID | 5387558 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (4Z,6Z)-4,6-dibenzylidene-2,2-dimethyl-1,3-dioxan-5-one |
| SMILES | CC1(C)O/C(=C\c2ccccc2)C(=O)/C(=C/c2ccccc2)O1 |
| InChI | InChI=1S/C20H18O3/c1-20(2)22-17(13-15-9-5-3-6-10-15)19(21)18(23-20)14-16-11-7-4-8-12-16/h3-14H,1-2H3/b17-13-,18-14- |
| InChIKey | QGRDVHZIDHEPCR-JTFWXBGUSA-N |
| XLogP | 4.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|