C28H32O7 — CID 5387611
(4Z,9Z,14Z)-2,2,7,7,12,12,17,17-octamethyl-21-oxabicyclo[16.2.1]henicosa-1(20),4,9,14,18-pentaene-3,6,8,11,13,16-hexone (PubChem CID 5387611) has the molecular formula C28H32O7 and a molecular weight of 480.56 g/mol. Its IUPAC name is (4Z,9Z,14Z)-2,2,7,7,12,12,17,17-octamethyl-21-oxabicyclo[16.2.1]henicosa-1(20),4,9,14,18-pentaene-3,6,8,11,13,16-hexone.
| Compound Name | (4Z,9Z,14Z)-2,2,7,7,12,12,17,17-octamethyl-21-oxabicyclo[16.2.1]henicosa-1(20),4,9,14,18-pentaene-3,6,8,11,13,16-hexone |
|---|---|
| PubChem CID | 5387611 |
| Molecular Formula | C28H32O7 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | (4Z,9Z,14Z)-2,2,7,7,12,12,17,17-octamethyl-21-oxabicyclo[16.2.1]henicosa-1(20),4,9,14,18-pentaene-3,6,8,11,13,16-hexone |
| SMILES | CC1(C)C(=O)/C=C\C(=O)C(C)(C)C(=O)/C=C\C(=O)C(C)(C)c2ccc(o2)C(C)(C)C(=O)/C=C\C1=O |
| InChI | InChI=1S/C28H32O7/c1-25(2)17(29)9-10-18(30)26(3,4)20(32)12-14-22(34)28(7,8)24-16-15-23(35-24)27(5,6)21(33)13-11-19(25)31/h9-16H,1-8H3/b10-9-,13-11-,14-12- |
| InChIKey | OAVCWCVIFBSXIA-OXJRGYCCSA-N |
| XLogP | 3.98 |
| TPSA | 115.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|