C28H32O8 — CID 5387612
(4Z,9Z,14Z,19Z)-2,2,7,7,12,12,17,17-octamethylcycloicosa-4,9,14,19-tetraene-1,3,6,8,11,13,16,18-octone (PubChem CID 5387612) has the molecular formula C28H32O8 and a molecular weight of 496.56 g/mol. Its IUPAC name is (4Z,9Z,14Z,19Z)-2,2,7,7,12,12,17,17-octamethylcycloicosa-4,9,14,19-tetraene-1,3,6,8,11,13,16,18-octone.
| Compound Name | (4Z,9Z,14Z,19Z)-2,2,7,7,12,12,17,17-octamethylcycloicosa-4,9,14,19-tetraene-1,3,6,8,11,13,16,18-octone |
|---|---|
| PubChem CID | 5387612 |
| Molecular Formula | C28H32O8 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (4Z,9Z,14Z,19Z)-2,2,7,7,12,12,17,17-octamethylcycloicosa-4,9,14,19-tetraene-1,3,6,8,11,13,16,18-octone |
| SMILES | CC1(C)C(=O)/C=C\C(=O)C(C)(C)C(=O)/C=C\C(=O)C(C)(C)C(=O)/C=C\C(=O)C(C)(C)C(=O)/C=C\C1=O |
| InChI | InChI=1S/C28H32O8/c1-25(2)17(29)9-11-19(31)26(3,4)21(33)13-15-23(35)28(7,8)24(36)16-14-22(34)27(5,6)20(32)12-10-18(25)30/h9-16H,1-8H3/b11-9-,12-10-,15-13-,16-14- |
| InChIKey | ZESYLGKHDBKSPD-LUHLCGLTSA-N |
| XLogP | 2.88 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|