C18H28O5 — CID 5387795
(3Z,5R,6S)-3-[(5R)-5-butyloxolan-2-ylidene]-5-hydroxy-6-pentyloxane-2,4-dione (PubChem CID 5387795) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (3Z,5R,6S)-3-[(5R)-5-butyloxolan-2-ylidene]-5-hydroxy-6-pentyloxane-2,4-dione.
| Compound Name | (3Z,5R,6S)-3-[(5R)-5-butyloxolan-2-ylidene]-5-hydroxy-6-pentyloxane-2,4-dione |
|---|---|
| PubChem CID | 5387795 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (3Z,5R,6S)-3-[(5R)-5-butyloxolan-2-ylidene]-5-hydroxy-6-pentyloxane-2,4-dione |
| SMILES | CCCCC[C@@H]1OC(=O)/C(=C2/CC[C@@H](CCCC)O2)C(=O)[C@@H]1O |
| InChI | InChI=1S/C18H28O5/c1-3-5-7-9-14-16(19)17(20)15(18(21)23-14)13-11-10-12(22-13)8-6-4-2/h12,14,16,19H,3-11H2,1-2H3/b15-13-/t12-,14+,16-/m1/s1 |
| InChIKey | XUXPQZIAHQAQKO-IBXNSZIFSA-N |
| XLogP | 3.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|