C25H25NO6 — CID 5387839
dimethyl (Z)-2-(15,16-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-8-yl)but-2-enedioate (PubChem CID 5387839) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is dimethyl (Z)-2-(15,16-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-8-yl)but-2-enedioate.
| Compound Name | dimethyl (Z)-2-(15,16-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-8-yl)but-2-enedioate |
|---|---|
| PubChem CID | 5387839 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | dimethyl (Z)-2-(15,16-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaen-8-yl)but-2-enedioate |
| SMILES | COC(=O)/C=C(\C(=O)OC)c1c2c3c(cc(OC)c(OC)c3c3ccccc13)CCN2C |
| InChI | InChI=1S/C25H25NO6/c1-26-11-10-14-12-18(29-2)24(31-4)22-16-9-7-6-8-15(16)21(23(26)20(14)22)17(25(28)32-5)13-19(27)30-3/h6-9,12-13H,10-11H2,1-5H3/b17-13- |
| InChIKey | OAKKXCBZUINRQN-LGMDPLHJSA-N |
| XLogP | 3.73 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|