About dimethyl 2-acetamidobutanedioate
dimethyl 2-acetamidobutanedioate (PubChem CID 538799) has the molecular formula C8H13NO5
and a molecular weight of 203.19 g/mol. Its IUPAC name is dimethyl 2-acetamidobutanedioate.
Molecular Properties
| Compound Name | dimethyl 2-acetamidobutanedioate |
| PubChem CID | 538799 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | dimethyl 2-acetamidobutanedioate |
| SMILES | COC(=O)CC(NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C8H13NO5/c1-5(10)9-6(8(12)14-3)4-7(11)13-2/h6H,4H2,1-3H3,(H,9,10) |
| InChIKey | VRPXVQSXUIFMKQ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dimethyl 2-acetamidobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-acetamidobutanedioate?
The IUPAC name of dimethyl 2-acetamidobutanedioate (CID 538799) is dimethyl 2-acetamidobutanedioate.
What is the SMILES notation for dimethyl 2-acetamidobutanedioate?
The canonical SMILES for dimethyl 2-acetamidobutanedioate is COC(=O)CC(NC(C)=O)C(=O)OC.
What is the InChIKey of dimethyl 2-acetamidobutanedioate?
The InChIKey is VRPXVQSXUIFMKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO5/c1-5(10)9-6(8(12)14-3)4-7(11)13-2/h6H,4H2,1-3H3,(H,9,10).
What are the key properties of dimethyl 2-acetamidobutanedioate?
dimethyl 2-acetamidobutanedioate has a molecular weight of 203.19 g/mol, XLogP of -0.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-acetamidobutanedioate is sourced from PubChem (CID 538799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).