C18H14O2 — CID 5388190
(11E,14E)-tricyclo[8.5.1.03,8]hexadeca-1,3,5,7,9,11,14-heptaene-12,14-dicarbaldehyde (PubChem CID 5388190) has the molecular formula C18H14O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is (11E,14E)-tricyclo[8.5.1.03,8]hexadeca-1,3,5,7,9,11,14-heptaene-12,14-dicarbaldehyde.
| Compound Name | (11E,14E)-tricyclo[8.5.1.03,8]hexadeca-1,3,5,7,9,11,14-heptaene-12,14-dicarbaldehyde |
|---|---|
| PubChem CID | 5388190 |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (11E,14E)-tricyclo[8.5.1.03,8]hexadeca-1,3,5,7,9,11,14-heptaene-12,14-dicarbaldehyde |
| SMILES | O=C/C1=C/C2=Cc3ccccc3C=C(/C=C(/C=O)C1)C2 |
| InChI | InChI=1S/C18H14O2/c19-11-15-6-13-5-14(7-16(8-15)12-20)10-18-4-2-1-3-17(18)9-13/h1-4,6-7,9-12H,5,8H2/b15-6+,16-7+ |
| InChIKey | FRXJPZZVAFPIRI-MBGCCUORSA-N |
| XLogP | 3.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|