About dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one
dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one (PubChem CID 5388208) has the molecular formula C15H25NO2Sn
and a molecular weight of 370.08 g/mol. Its IUPAC name is dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one |
| PubChem CID | 5388208 |
| Molecular Formula | C15H25NO2Sn |
| Molecular Weight | 370.08 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one |
| SMILES | CCCC[Sn]CCCC.O=C1C=CC=C/C1=C/NO |
| InChI | InChI=1S/C7H7NO2.2C4H9.Sn/c9-7-4-2-1-3-6(7)5-8-10;2*1-3-4-2;/h1-5,8,10H;2*1,3-4H2,2H3;/b6-5-;;; |
| InChIKey | RPDBBKQWJSDNOE-WTUPQPTJSA-N |
| XLogP | 3.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.08 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one?
The IUPAC name of dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one (CID 5388208) is dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one.
What is the SMILES notation for dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one?
The canonical SMILES for dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one is CCCC[Sn]CCCC.O=C1C=CC=C/C1=C/NO.
What is the InChIKey of dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one?
The InChIKey is RPDBBKQWJSDNOE-WTUPQPTJSA-N. The full InChI is InChI=1S/C7H7NO2.2C4H9.Sn/c9-7-4-2-1-3-6(7)5-8-10;2*1-3-4-2;/h1-5,8,10H;2*1,3-4H2,2H3;/b6-5-;;;.
What are the key properties of dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one?
dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one has a molecular weight of 370.08 g/mol, XLogP of 3.67, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyltin;(6Z)-6-[(hydroxyamino)methylidene]cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 5388208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).