C19H34O4Si — CID 5388218
2-[(E)-1-[tert-butyl(dimethyl)silyl]oxypent-2-enyl]-3,3a,6,7,8,8a-hexahydro-2H-furo[3,2-b]oxepin-5-one (PubChem CID 5388218) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is 2-[(E)-1-[tert-butyl(dimethyl)silyl]oxypent-2-enyl]-3,3a,6,7,8,8a-hexahydro-2H-furo[3,2-b]oxepin-5-one.
| Compound Name | 2-[(E)-1-[tert-butyl(dimethyl)silyl]oxypent-2-enyl]-3,3a,6,7,8,8a-hexahydro-2H-furo[3,2-b]oxepin-5-one |
|---|---|
| PubChem CID | 5388218 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-[(E)-1-[tert-butyl(dimethyl)silyl]oxypent-2-enyl]-3,3a,6,7,8,8a-hexahydro-2H-furo[3,2-b]oxepin-5-one |
| SMILES | CC/C=C/C(O[Si](C)(C)C(C)(C)C)C1CC2OC(=O)CCCC2O1 |
| InChI | InChI=1S/C19H34O4Si/c1-7-8-10-15(23-24(5,6)19(2,3)4)17-13-16-14(21-17)11-9-12-18(20)22-16/h8,10,14-17H,7,9,11-13H2,1-6H3/b10-8+ |
| InChIKey | GCLXHWLGCYDEMG-CSKARUKUSA-N |
| XLogP | 4.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|