C14H18O2 — CID 5388509
(E)-1-(3-methoxyphenyl)-4,4-dimethylpent-1-en-3-one (PubChem CID 5388509) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (E)-1-(3-methoxyphenyl)-4,4-dimethylpent-1-en-3-one.
| Compound Name | (E)-1-(3-methoxyphenyl)-4,4-dimethylpent-1-en-3-one |
|---|---|
| PubChem CID | 5388509 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (E)-1-(3-methoxyphenyl)-4,4-dimethylpent-1-en-3-one |
| SMILES | COc1cccc(/C=C/C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H18O2/c1-14(2,3)13(15)9-8-11-6-5-7-12(10-11)16-4/h5-10H,1-4H3/b9-8+ |
| InChIKey | VYVFVGZXQUUPGE-CMDGGOBGSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|