C16H21NO4 — CID 5388763
ethyl 5-[(1E,3E)-5-methoxy-3-methyl-5-oxopenta-1,3-dienyl]-1,2-dimethylpyrrole-3-carboxylate (PubChem CID 5388763) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is ethyl 5-[(1E,3E)-5-methoxy-3-methyl-5-oxopenta-1,3-dienyl]-1,2-dimethylpyrrole-3-carboxylate.
| Compound Name | ethyl 5-[(1E,3E)-5-methoxy-3-methyl-5-oxopenta-1,3-dienyl]-1,2-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 5388763 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | ethyl 5-[(1E,3E)-5-methoxy-3-methyl-5-oxopenta-1,3-dienyl]-1,2-dimethylpyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(/C=C/C(C)=C/C(=O)OC)n(C)c1C |
| InChI | InChI=1S/C16H21NO4/c1-6-21-16(19)14-10-13(17(4)12(14)3)8-7-11(2)9-15(18)20-5/h7-10H,6H2,1-5H3/b8-7+,11-9+ |
| InChIKey | KKXKUNPOYVZWKX-MFDVASPDSA-N |
| XLogP | 2.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|