About tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane
tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane (PubChem CID 5388771) has the molecular formula C23H32O4Si
and a molecular weight of 400.59 g/mol. Its IUPAC name is tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane |
| PubChem CID | 5388771 |
| Molecular Formula | C23H32O4Si |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(O[Si](C)(C)C(C)(C)C)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H32O4Si/c1-23(2,3)28(7,8)27-22-20(25-5)15-18(16-21(22)26-6)10-9-17-11-13-19(24-4)14-12-17/h9-16H,1-8H3/b10-9- |
| InChIKey | QYELFYNGCBSTLN-KTKRTIGZSA-N |
| XLogP | 6.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane?
The IUPAC name of tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane (CID 5388771) is tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane is COc1ccc(/C=C\c2cc(OC)c(O[Si](C)(C)C(C)(C)C)c(OC)c2)cc1.
What is the InChIKey of tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane?
The InChIKey is QYELFYNGCBSTLN-KTKRTIGZSA-N. The full InChI is InChI=1S/C23H32O4Si/c1-23(2,3)28(7,8)27-22-20(25-5)15-18(16-21(22)26-6)10-9-17-11-13-19(24-4)14-12-17/h9-16H,1-8H3/b10-9-.
What are the key properties of tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane?
tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane has a molecular weight of 400.59 g/mol, XLogP of 6.27, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[2,6-dimethoxy-4-[(Z)-2-(4-methoxyphenyl)ethenyl]phenoxy]-dimethylsilane is sourced from PubChem (CID 5388771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).