C19H13Cl4NO — CID 5388806
(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]piperidin-4-one (PubChem CID 5388806) has the molecular formula C19H13Cl4NO and a molecular weight of 413.13 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 5388806 |
| Molecular Formula | C19H13Cl4NO |
| Molecular Weight | 413.13 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]piperidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)c(Cl)c2)CNC/C1=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H13Cl4NO/c20-15-3-1-11(7-17(15)22)5-13-9-24-10-14(19(13)25)6-12-2-4-16(21)18(23)8-12/h1-8,24H,9-10H2/b13-5+,14-6+ |
| InChIKey | GJPXGFGIFQWUOC-ACFHMISVSA-N |
| XLogP | 5.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.13 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|