C22H15Cl4NO2 — CID 5388807
(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-1-prop-2-enoylpiperidin-4-one (PubChem CID 5388807) has the molecular formula C22H15Cl4NO2 and a molecular weight of 467.18 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-1-prop-2-enoylpiperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-1-prop-2-enoylpiperidin-4-one |
|---|---|
| PubChem CID | 5388807 |
| Molecular Formula | C22H15Cl4NO2 |
| Molecular Weight | 467.18 g/mol |
| Exact Mass | 464.99 |
| IUPAC Name | (3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-1-prop-2-enoylpiperidin-4-one |
| SMILES | C=CC(=O)N1C/C(=C\c2ccc(Cl)c(Cl)c2)C(=O)/C(=C/c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C22H15Cl4NO2/c1-2-21(28)27-11-15(7-13-3-5-17(23)19(25)9-13)22(29)16(12-27)8-14-4-6-18(24)20(26)10-14/h2-10H,1,11-12H2/b15-7+,16-8+ |
| InChIKey | FBZOBWNZGBPYHT-BGPOSVGRSA-N |
| XLogP | 6.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.18 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|