About (E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine
(E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine (PubChem CID 5389005) has the molecular formula C14H15N3
and a molecular weight of 225.30 g/mol. Its IUPAC name is (E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine.
Molecular Properties
| Compound Name | (E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine |
| PubChem CID | 5389005 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine |
| SMILES | Cc1c(/N=C/C=C/c2ccccc2)cnn1C |
| InChI | InChI=1S/C14H15N3/c1-12-14(11-16-17(12)2)15-10-6-9-13-7-4-3-5-8-13/h3-11H,1-2H3/b9-6+,15-10+ |
| InChIKey | RZKONRBUXFZTJI-UJHPFZFGSA-N |
| XLogP | 3.14 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine?
The IUPAC name of (E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine (CID 5389005) is (E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine.
What is the SMILES notation for (E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine?
The canonical SMILES for (E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine is Cc1c(/N=C/C=C/c2ccccc2)cnn1C.
What is the InChIKey of (E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine?
The InChIKey is RZKONRBUXFZTJI-UJHPFZFGSA-N. The full InChI is InChI=1S/C14H15N3/c1-12-14(11-16-17(12)2)15-10-6-9-13-7-4-3-5-8-13/h3-11H,1-2H3/b9-6+,15-10+.
What are the key properties of (E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine?
(E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine has a molecular weight of 225.30 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(1,5-dimethylpyrazol-4-yl)-3-phenylprop-2-en-1-imine is sourced from PubChem (CID 5389005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).