About (2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone
(2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone (PubChem CID 5389116) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is (2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone.
Molecular Properties
| Compound Name | (2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone |
| PubChem CID | 5389116 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone |
| SMILES | CC1N/C(=C\C(=O)c2ccccc2)N(O)C1(C)C |
| InChI | InChI=1S/C14H18N2O2/c1-10-14(2,3)16(18)13(15-10)9-12(17)11-7-5-4-6-8-11/h4-10,15,18H,1-3H3/b13-9+ |
| InChIKey | QBKYOVZJSJZBIZ-UKTHLTGXSA-N |
| XLogP | 2.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone?
The IUPAC name of (2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone (CID 5389116) is (2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone.
What is the SMILES notation for (2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone?
The canonical SMILES for (2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone is CC1N/C(=C\C(=O)c2ccccc2)N(O)C1(C)C.
What is the InChIKey of (2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone?
The InChIKey is QBKYOVZJSJZBIZ-UKTHLTGXSA-N. The full InChI is InChI=1S/C14H18N2O2/c1-10-14(2,3)16(18)13(15-10)9-12(17)11-7-5-4-6-8-11/h4-10,15,18H,1-3H3/b13-9+.
What are the key properties of (2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone?
(2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone has a molecular weight of 246.31 g/mol, XLogP of 2.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(1-hydroxy-4,5,5-trimethylimidazolidin-2-ylidene)-1-phenylethanone is sourced from PubChem (CID 5389116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).