C24H28N2O5 — CID 5389285
butyl (4S)-2-amino-1',7,7-trimethyl-2',5-dioxospiro[6,8-dihydrochromene-4,3'-indole]-3-carboxylate (PubChem CID 5389285) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is butyl (4S)-2-amino-1',7,7-trimethyl-2',5-dioxospiro[6,8-dihydrochromene-4,3'-indole]-3-carboxylate.
| Compound Name | butyl (4S)-2-amino-1',7,7-trimethyl-2',5-dioxospiro[6,8-dihydrochromene-4,3'-indole]-3-carboxylate |
|---|---|
| PubChem CID | 5389285 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | butyl (4S)-2-amino-1',7,7-trimethyl-2',5-dioxospiro[6,8-dihydrochromene-4,3'-indole]-3-carboxylate |
| SMILES | CCCCOC(=O)C1=C(N)OC2=C(C(=O)CC(C)(C)C2)[C@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C24H28N2O5/c1-5-6-11-30-21(28)19-20(25)31-17-13-23(2,3)12-16(27)18(17)24(19)14-9-7-8-10-15(14)26(4)22(24)29/h7-10H,5-6,11-13,25H2,1-4H3/t24-/m0/s1 |
| InChIKey | OGCRDKWOKYUQCM-DEOSSOPVSA-N |
| XLogP | 3.09 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|