C22H24N2O5 — CID 5389313
butyl (4S)-2-amino-1'-methyl-2',5-dioxospiro[7,8-dihydro-6H-chromene-4,3'-indole]-3-carboxylate (PubChem CID 5389313) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is butyl (4S)-2-amino-1'-methyl-2',5-dioxospiro[7,8-dihydro-6H-chromene-4,3'-indole]-3-carboxylate.
| Compound Name | butyl (4S)-2-amino-1'-methyl-2',5-dioxospiro[7,8-dihydro-6H-chromene-4,3'-indole]-3-carboxylate |
|---|---|
| PubChem CID | 5389313 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | butyl (4S)-2-amino-1'-methyl-2',5-dioxospiro[7,8-dihydro-6H-chromene-4,3'-indole]-3-carboxylate |
| SMILES | CCCCOC(=O)C1=C(N)OC2=C(C(=O)CCC2)[C@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C22H24N2O5/c1-3-4-12-28-20(26)18-19(23)29-16-11-7-10-15(25)17(16)22(18)13-8-5-6-9-14(13)24(2)21(22)27/h5-6,8-9H,3-4,7,10-12,23H2,1-2H3/t22-/m0/s1 |
| InChIKey | NJMKGGZSPDALAL-QFIPXVFZSA-N |
| XLogP | 2.45 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|