About (Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol
(Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol (PubChem CID 5389617) has the molecular formula C16H16O5S2
and a molecular weight of 352.43 g/mol. Its IUPAC name is (Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol.
Molecular Properties
| Compound Name | (Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol |
| PubChem CID | 5389617 |
| Molecular Formula | C16H16O5S2 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | (Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol |
| SMILES | O=S(=O)(C/C(=C/CO)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16O5S2/c17-12-11-16(23(20,21)15-9-5-2-6-10-15)13-22(18,19)14-7-3-1-4-8-14/h1-11,17H,12-13H2/b16-11- |
| InChIKey | AIAKDUWZCKEZRU-WJDWOHSUSA-N |
| XLogP | 1.81 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol?
The IUPAC name of (Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol (CID 5389617) is (Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol.
What is the SMILES notation for (Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol?
The canonical SMILES for (Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol is O=S(=O)(C/C(=C/CO)S(=O)(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of (Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol?
The InChIKey is AIAKDUWZCKEZRU-WJDWOHSUSA-N. The full InChI is InChI=1S/C16H16O5S2/c17-12-11-16(23(20,21)15-9-5-2-6-10-15)13-22(18,19)14-7-3-1-4-8-14/h1-11,17H,12-13H2/b16-11-.
What are the key properties of (Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol?
(Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol has a molecular weight of 352.43 g/mol, XLogP of 1.81, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,4-bis(benzenesulfonyl)but-2-en-1-ol is sourced from PubChem (CID 5389617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).