About 6,8-dibromo-2-methyl-3,1-benzoxazin-4-one
6,8-dibromo-2-methyl-3,1-benzoxazin-4-one (PubChem CID 538999) has the molecular formula C9H5Br2NO2
and a molecular weight of 318.95 g/mol. Its IUPAC name is 6,8-dibromo-2-methyl-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 6,8-dibromo-2-methyl-3,1-benzoxazin-4-one |
| PubChem CID | 538999 |
| Molecular Formula | C9H5Br2NO2 |
| Molecular Weight | 318.95 g/mol |
| Exact Mass | 316.87 |
| IUPAC Name | 6,8-dibromo-2-methyl-3,1-benzoxazin-4-one |
| SMILES | Cc1nc2c(Br)cc(Br)cc2c(=O)o1 |
| InChI | InChI=1S/C9H5Br2NO2/c1-4-12-8-6(9(13)14-4)2-5(10)3-7(8)11/h2-3H,1H3 |
| InChIKey | CXSLXQBVVGPWQL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.95 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-dibromo-2-methyl-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dibromo-2-methyl-3,1-benzoxazin-4-one?
The IUPAC name of 6,8-dibromo-2-methyl-3,1-benzoxazin-4-one (CID 538999) is 6,8-dibromo-2-methyl-3,1-benzoxazin-4-one.
What is the SMILES notation for 6,8-dibromo-2-methyl-3,1-benzoxazin-4-one?
The canonical SMILES for 6,8-dibromo-2-methyl-3,1-benzoxazin-4-one is Cc1nc2c(Br)cc(Br)cc2c(=O)o1.
What is the InChIKey of 6,8-dibromo-2-methyl-3,1-benzoxazin-4-one?
The InChIKey is CXSLXQBVVGPWQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Br2NO2/c1-4-12-8-6(9(13)14-4)2-5(10)3-7(8)11/h2-3H,1H3.
What are the key properties of 6,8-dibromo-2-methyl-3,1-benzoxazin-4-one?
6,8-dibromo-2-methyl-3,1-benzoxazin-4-one has a molecular weight of 318.95 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dibromo-2-methyl-3,1-benzoxazin-4-one is sourced from PubChem (CID 538999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).