C24H22ClN3O3 — CID 5389991
(3S,3'aR,8'aS,8'bS)-2'-benzyl-5-chloro-7-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione (PubChem CID 5389991) has the molecular formula C24H22ClN3O3 and a molecular weight of 435.91 g/mol. Its IUPAC name is (3S,3'aR,8'aS,8'bS)-2'-benzyl-5-chloro-7-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione.
| Compound Name | (3S,3'aR,8'aS,8'bS)-2'-benzyl-5-chloro-7-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
|---|---|
| PubChem CID | 5389991 |
| Molecular Formula | C24H22ClN3O3 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | (3S,3'aR,8'aS,8'bS)-2'-benzyl-5-chloro-7-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
| SMILES | Cc1cc(Cl)cc2c1NC(=O)[C@]21[C@@H]2C(=O)N(Cc3ccccc3)C(=O)[C@@H]2[C@@H]2CCCN21 |
| InChI | InChI=1S/C24H22ClN3O3/c1-13-10-15(25)11-16-20(13)26-23(31)24(16)19-18(17-8-5-9-28(17)24)21(29)27(22(19)30)12-14-6-3-2-4-7-14/h2-4,6-7,10-11,17-19H,5,8-9,12H2,1H3,(H,26,31)/t17-,18+,19-,24+/m0/s1 |
| InChIKey | KPCDIXZQWAGUSI-UAKAABGRSA-N |
| XLogP | 3.08 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|