About ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate
ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate (PubChem CID 539075) has the molecular formula C10H17F3N2O3
and a molecular weight of 270.25 g/mol. Its IUPAC name is ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate.
Molecular Properties
| Compound Name | ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate |
| PubChem CID | 539075 |
| Molecular Formula | C10H17F3N2O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate |
| SMILES | CCOC(=O)C(NC(C)=O)(NC(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O3/c1-5-18-8(17)9(10(11,12)13,14-6(2)3)15-7(4)16/h6,14H,5H2,1-4H3,(H,15,16) |
| InChIKey | GTNNLYUVCAMUEI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate?
The IUPAC name of ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate (CID 539075) is ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate.
What is the SMILES notation for ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate?
The canonical SMILES for ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate is CCOC(=O)C(NC(C)=O)(NC(C)C)C(F)(F)F.
What is the InChIKey of ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate?
The InChIKey is GTNNLYUVCAMUEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O3/c1-5-18-8(17)9(10(11,12)13,14-6(2)3)15-7(4)16/h6,14H,5H2,1-4H3,(H,15,16).
What are the key properties of ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate?
ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate has a molecular weight of 270.25 g/mol, XLogP of 0.94, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-acetamido-3,3,3-trifluoro-2-(propan-2-ylamino)propanoate is sourced from PubChem (CID 539075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).