C16H20O — CID 539121
10-but-3-en-2-yltricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-ol (PubChem CID 539121) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is 10-but-3-en-2-yltricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-ol.
| Compound Name | 10-but-3-en-2-yltricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-ol |
|---|---|
| PubChem CID | 539121 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 10-but-3-en-2-yltricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-ol |
| SMILES | C=CC(C)C1(O)CC2CC(C1)c1ccccc12 |
| InChI | InChI=1S/C16H20O/c1-3-11(2)16(17)9-12-8-13(10-16)15-7-5-4-6-14(12)15/h3-7,11-13,17H,1,8-10H2,2H3 |
| InChIKey | RLZYKBYXRMXIBI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|