C23H30O4 — CID 539283
(3a,4',4',6-tetramethyl-5',9-dioxospiro[1,2,3,4,5,6,8,9b-octahydrocyclopenta[a]naphthalene-7,3'-cyclopentene]-3-yl) acetate (PubChem CID 539283) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (3a,4',4',6-tetramethyl-5',9-dioxospiro[1,2,3,4,5,6,8,9b-octahydrocyclopenta[a]naphthalene-7,3'-cyclopentene]-3-yl) acetate.
| Compound Name | (3a,4',4',6-tetramethyl-5',9-dioxospiro[1,2,3,4,5,6,8,9b-octahydrocyclopenta[a]naphthalene-7,3'-cyclopentene]-3-yl) acetate |
|---|---|
| PubChem CID | 539283 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (3a,4',4',6-tetramethyl-5',9-dioxospiro[1,2,3,4,5,6,8,9b-octahydrocyclopenta[a]naphthalene-7,3'-cyclopentene]-3-yl) acetate |
| SMILES | CC(=O)OC1CCC2C3=C(CCC12C)C(C)C1(C=CC(=O)C1(C)C)CC3=O |
| InChI | InChI=1S/C23H30O4/c1-13-15-8-10-22(5)16(6-7-19(22)27-14(2)24)20(15)17(25)12-23(13)11-9-18(26)21(23,3)4/h9,11,13,16,19H,6-8,10,12H2,1-5H3 |
| InChIKey | KHTAZYNELAHYSL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |