About N-acetyl-4-methyl-1,3-oxazole-5-carboxamide
N-acetyl-4-methyl-1,3-oxazole-5-carboxamide (PubChem CID 539390) has the molecular formula C7H8N2O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is N-acetyl-4-methyl-1,3-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-acetyl-4-methyl-1,3-oxazole-5-carboxamide |
| PubChem CID | 539390 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | N-acetyl-4-methyl-1,3-oxazole-5-carboxamide |
| SMILES | CC(=O)NC(=O)c1ocnc1C |
| InChI | InChI=1S/C7H8N2O3/c1-4-6(12-3-8-4)7(11)9-5(2)10/h3H,1-2H3,(H,9,10,11) |
| InChIKey | UJJAMBDUJUGPRL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-acetyl-4-methyl-1,3-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-4-methyl-1,3-oxazole-5-carboxamide?
The IUPAC name of N-acetyl-4-methyl-1,3-oxazole-5-carboxamide (CID 539390) is N-acetyl-4-methyl-1,3-oxazole-5-carboxamide.
What is the SMILES notation for N-acetyl-4-methyl-1,3-oxazole-5-carboxamide?
The canonical SMILES for N-acetyl-4-methyl-1,3-oxazole-5-carboxamide is CC(=O)NC(=O)c1ocnc1C.
What is the InChIKey of N-acetyl-4-methyl-1,3-oxazole-5-carboxamide?
The InChIKey is UJJAMBDUJUGPRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c1-4-6(12-3-8-4)7(11)9-5(2)10/h3H,1-2H3,(H,9,10,11).
What are the key properties of N-acetyl-4-methyl-1,3-oxazole-5-carboxamide?
N-acetyl-4-methyl-1,3-oxazole-5-carboxamide has a molecular weight of 168.15 g/mol, XLogP of 0.26, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-4-methyl-1,3-oxazole-5-carboxamide is sourced from PubChem (CID 539390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).