About (2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate
(2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate (PubChem CID 539455) has the molecular formula C15H26O9
and a molecular weight of 350.36 g/mol. Its IUPAC name is (2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate.
Molecular Properties
| Compound Name | (2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate |
| PubChem CID | 539455 |
| Molecular Formula | C15H26O9 |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate |
| SMILES | COCC(OC(C)=O)C(OC)C(OC)C(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C15H26O9/c1-9(16)22-8-13(24-11(3)18)15(21-6)14(20-5)12(7-19-4)23-10(2)17/h12-15H,7-8H2,1-6H3 |
| InChIKey | JTIPYRUUQYKTIG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze (2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate?
The IUPAC name of (2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate (CID 539455) is (2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate.
What is the SMILES notation for (2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate?
The canonical SMILES for (2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate is COCC(OC(C)=O)C(OC)C(OC)C(COC(C)=O)OC(C)=O.
What is the InChIKey of (2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate?
The InChIKey is JTIPYRUUQYKTIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O9/c1-9(16)22-8-13(24-11(3)18)15(21-6)14(20-5)12(7-19-4)23-10(2)17/h12-15H,7-8H2,1-6H3.
What are the key properties of (2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate?
(2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate has a molecular weight of 350.36 g/mol, XLogP of 0.09, 11 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-diacetyloxy-3,4,6-trimethoxyhexyl) acetate is sourced from PubChem (CID 539455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).