C10H11F5O4S — CID 539503
methyl 2-[2,4-dioxopentan-3-ylsulfanyl(difluoro)methyl]-3,3,3-trifluoropropanoate (PubChem CID 539503) has the molecular formula C10H11F5O4S and a molecular weight of 322.25 g/mol. Its IUPAC name is methyl 2-[2,4-dioxopentan-3-ylsulfanyl(difluoro)methyl]-3,3,3-trifluoropropanoate.
| Compound Name | methyl 2-[2,4-dioxopentan-3-ylsulfanyl(difluoro)methyl]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 539503 |
| Molecular Formula | C10H11F5O4S |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | methyl 2-[2,4-dioxopentan-3-ylsulfanyl(difluoro)methyl]-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)C(C(F)(F)F)C(F)(F)SC(C(C)=O)C(C)=O |
| InChI | InChI=1S/C10H11F5O4S/c1-4(16)6(5(2)17)20-10(14,15)7(8(18)19-3)9(11,12)13/h6-7H,1-3H3 |
| InChIKey | UHBCHPAABXCBQC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|