C5H3F7N4 — CID 539515
5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-1,2,4-triazol-3-amine (PubChem CID 539515) has the molecular formula C5H3F7N4 and a molecular weight of 252.09 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 539515 |
| Molecular Formula | C5H3F7N4 |
| Molecular Weight | 252.09 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(C(F)(F)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C5H3F7N4/c6-3(7,1-14-2(13)16-15-1)4(8,9)5(10,11)12/h(H3,13,14,15,16) |
| InChIKey | WRONHTPBJGQDGJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.09 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|