C13H14N2O2 — CID 5395603
(4E,5R)-4-(1-aminoethylidene)-1-methyl-5-phenylpyrrolidine-2,3-dione (PubChem CID 5395603) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is (4E,5R)-4-(1-aminoethylidene)-1-methyl-5-phenylpyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-4-(1-aminoethylidene)-1-methyl-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5395603 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (4E,5R)-4-(1-aminoethylidene)-1-methyl-5-phenylpyrrolidine-2,3-dione |
| SMILES | C/C(N)=C1\C(=O)C(=O)N(C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H14N2O2/c1-8(14)10-11(9-6-4-3-5-7-9)15(2)13(17)12(10)16/h3-7,11H,14H2,1-2H3/b10-8+/t11-/m1/s1 |
| InChIKey | NFJVDNZGCRQMRP-RJCSOLBVSA-N |
| XLogP | 1.00 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|