C12H16N2O — CID 5395711
(NE)-N-(2,7,7-trimethyl-6,8-dihydroquinolin-5-ylidene)hydroxylamine (PubChem CID 5395711) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (NE)-N-(2,7,7-trimethyl-6,8-dihydroquinolin-5-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(2,7,7-trimethyl-6,8-dihydroquinolin-5-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 5395711 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (NE)-N-(2,7,7-trimethyl-6,8-dihydroquinolin-5-ylidene)hydroxylamine |
| SMILES | Cc1ccc2c(n1)CC(C)(C)C/C2=N\O |
| InChI | InChI=1S/C12H16N2O/c1-8-4-5-9-10(13-8)6-12(2,3)7-11(9)14-15/h4-5,15H,6-7H2,1-3H3/b14-11+ |
| InChIKey | QHQDIDIONQYSLD-SDNWHVSQSA-N |
| XLogP | 2.54 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|