About 5-(2-oxopropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one
5-(2-oxopropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 539626) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 5-(2-oxopropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
Analyze 5-(2-oxopropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-oxopropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one?
The IUPAC name of 5-(2-oxopropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (CID 539626) is 5-(2-oxopropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
What is the SMILES notation for 5-(2-oxopropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one?
The canonical SMILES for 5-(2-oxopropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one is CC(=O)CC1CCC2CCC(=O)N21.
What is the InChIKey of 5-(2-oxopropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one?
The InChIKey is IKYMVCSCLTZRGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-7(12)6-9-3-2-8-4-5-10(13)11(8)9/h8-9H,2-6H2,1H3.
What are the key properties of 5-(2-oxopropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one?
5-(2-oxopropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one has a molecular weight of 181.23 g/mol, XLogP of 1.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-oxopropyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one is sourced from PubChem (CID 539626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).