C17H18F2N2O3 — CID 5396307
(2R)-2-[4-(difluoromethoxy)phenyl]-N-[(Z)-furan-2-ylmethylideneamino]-3-methylbutanamide (PubChem CID 5396307) has the molecular formula C17H18F2N2O3 and a molecular weight of 336.34 g/mol. Its IUPAC name is (2R)-2-[4-(difluoromethoxy)phenyl]-N-[(Z)-furan-2-ylmethylideneamino]-3-methylbutanamide.
| Compound Name | (2R)-2-[4-(difluoromethoxy)phenyl]-N-[(Z)-furan-2-ylmethylideneamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 5396307 |
| Molecular Formula | C17H18F2N2O3 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (2R)-2-[4-(difluoromethoxy)phenyl]-N-[(Z)-furan-2-ylmethylideneamino]-3-methylbutanamide |
| SMILES | CC(C)[C@@H](C(=O)N/N=C\c1ccco1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H18F2N2O3/c1-11(2)15(12-5-7-13(8-6-12)24-17(18)19)16(22)21-20-10-14-4-3-9-23-14/h3-11,15,17H,1-2H3,(H,21,22)/b20-10-/t15-/m1/s1 |
| InChIKey | ONIIVFAYNFETHA-RKQRPNFGSA-N |
| XLogP | 3.77 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|