About [4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate
[4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate (PubChem CID 539638) has the molecular formula C19H24O10S
and a molecular weight of 444.46 g/mol. Its IUPAC name is [4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate.
Molecular Properties
| Compound Name | [4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
| PubChem CID | 539638 |
| Molecular Formula | C19H24O10S |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate |
| SMILES | CC(=O)OC1COC(COS(=O)(=O)c2ccc(C)cc2)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H24O10S/c1-11-5-7-15(8-6-11)30(23,24)26-10-16-18(28-13(3)21)19(29-14(4)22)17(9-25-16)27-12(2)20/h5-8,16-19H,9-10H2,1-4H3 |
| InChIKey | RJXNKVPCSACNNG-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate?
The IUPAC name of [4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate (CID 539638) is [4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate.
What is the SMILES notation for [4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate?
The canonical SMILES for [4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate is CC(=O)OC1COC(COS(=O)(=O)c2ccc(C)cc2)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of [4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate?
The InChIKey is RJXNKVPCSACNNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O10S/c1-11-5-7-15(8-6-11)30(23,24)26-10-16-18(28-13(3)21)19(29-14(4)22)17(9-25-16)27-12(2)20/h5-8,16-19H,9-10H2,1-4H3.
What are the key properties of [4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate?
[4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate has a molecular weight of 444.46 g/mol, XLogP of 0.89, 7 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-diacetyloxy-6-[(4-methylphenyl)sulfonyloxymethyl]oxan-3-yl] acetate is sourced from PubChem (CID 539638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).