About 7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one
7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one (PubChem CID 5396607) has the molecular formula C16H16N2O
and a molecular weight of 252.32 g/mol. Its IUPAC name is 7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one.
Molecular Properties
| Compound Name | 7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one |
| PubChem CID | 5396607 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one |
| SMILES | CCc1ccc2[nH]c3nc(C)cc(C)c3c(=O)c2c1 |
| InChI | InChI=1S/C16H16N2O/c1-4-11-5-6-13-12(8-11)15(19)14-9(2)7-10(3)17-16(14)18-13/h5-8H,4H2,1-3H3,(H,17,18,19) |
| InChIKey | DBZHPHGFYDFVDQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one?
The IUPAC name of 7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one (CID 5396607) is 7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one.
What is the SMILES notation for 7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one?
The canonical SMILES for 7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one is CCc1ccc2[nH]c3nc(C)cc(C)c3c(=O)c2c1.
What is the InChIKey of 7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one?
The InChIKey is DBZHPHGFYDFVDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O/c1-4-11-5-6-13-12(8-11)15(19)14-9(2)7-10(3)17-16(14)18-13/h5-8H,4H2,1-3H3,(H,17,18,19).
What are the key properties of 7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one?
7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one has a molecular weight of 252.32 g/mol, XLogP of 3.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2,4-dimethyl-10H-benzo[b][1,8]naphthyridin-5-one is sourced from PubChem (CID 5396607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).