C13H12N2O4 — CID 5397422
3,5-dihydroxy-N-[(Z)-(5-methylfuran-2-yl)methylideneamino]benzamide (PubChem CID 5397422) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 3,5-dihydroxy-N-[(Z)-(5-methylfuran-2-yl)methylideneamino]benzamide.
| Compound Name | 3,5-dihydroxy-N-[(Z)-(5-methylfuran-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 5397422 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 3,5-dihydroxy-N-[(Z)-(5-methylfuran-2-yl)methylideneamino]benzamide |
| SMILES | Cc1ccc(/C=N\NC(=O)c2cc(O)cc(O)c2)o1 |
| InChI | InChI=1S/C13H12N2O4/c1-8-2-3-12(19-8)7-14-15-13(18)9-4-10(16)6-11(17)5-9/h2-7,16-17H,1H3,(H,15,18)/b14-7- |
| InChIKey | PQXWMLILBGRAAS-AUWJEWJLSA-N |
| XLogP | 1.76 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|