About N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide
N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide (PubChem CID 5397447) has the molecular formula C17H18N2O4
and a molecular weight of 314.34 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide.
Molecular Properties
| Compound Name | N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide |
| PubChem CID | 5397447 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)c2ccccc2O)c(OC)c1 |
| InChI | InChI=1S/C17H18N2O4/c1-11(13-9-8-12(22-2)10-16(13)23-3)18-19-17(21)14-6-4-5-7-15(14)20/h4-10,20H,1-3H3,(H,19,21)/b18-11- |
| InChIKey | MOQSDPBUGLVWAZ-WQRHYEAKSA-N |
| XLogP | 2.56 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide?
The IUPAC name of N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide (CID 5397447) is N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide.
What is the SMILES notation for N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide?
The canonical SMILES for N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide is COc1ccc(/C(C)=N\NC(=O)c2ccccc2O)c(OC)c1.
What is the InChIKey of N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide?
The InChIKey is MOQSDPBUGLVWAZ-WQRHYEAKSA-N. The full InChI is InChI=1S/C17H18N2O4/c1-11(13-9-8-12(22-2)10-16(13)23-3)18-19-17(21)14-6-4-5-7-15(14)20/h4-10,20H,1-3H3,(H,19,21)/b18-11-.
What are the key properties of N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide?
N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide has a molecular weight of 314.34 g/mol, XLogP of 2.56, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-2-hydroxybenzamide is sourced from PubChem (CID 5397447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).