About 3,5-diacetyloxybenzoic acid
3,5-diacetyloxybenzoic acid (PubChem CID 539869) has the molecular formula C11H10O6
and a molecular weight of 238.19 g/mol. Its IUPAC name is 3,5-diacetyloxybenzoic acid.
Molecular Properties
| Compound Name | 3,5-diacetyloxybenzoic acid |
| PubChem CID | 539869 |
| Molecular Formula | C11H10O6 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 3,5-diacetyloxybenzoic acid |
| SMILES | CC(=O)Oc1cc(OC(C)=O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C11H10O6/c1-6(12)16-9-3-8(11(14)15)4-10(5-9)17-7(2)13/h3-5H,1-2H3,(H,14,15) |
| InChIKey | QBTDQJMLMVEUTQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diacetyloxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diacetyloxybenzoic acid?
The IUPAC name of 3,5-diacetyloxybenzoic acid (CID 539869) is 3,5-diacetyloxybenzoic acid.
What is the SMILES notation for 3,5-diacetyloxybenzoic acid?
The canonical SMILES for 3,5-diacetyloxybenzoic acid is CC(=O)Oc1cc(OC(C)=O)cc(C(=O)O)c1.
What is the InChIKey of 3,5-diacetyloxybenzoic acid?
The InChIKey is QBTDQJMLMVEUTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O6/c1-6(12)16-9-3-8(11(14)15)4-10(5-9)17-7(2)13/h3-5H,1-2H3,(H,14,15).
What are the key properties of 3,5-diacetyloxybenzoic acid?
3,5-diacetyloxybenzoic acid has a molecular weight of 238.19 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diacetyloxybenzoic acid is sourced from PubChem (CID 539869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).