C18H12F3NO2 — CID 5399584
(4Z)-2-(3-methylphenyl)-4-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 5399584) has the molecular formula C18H12F3NO2 and a molecular weight of 331.29 g/mol. Its IUPAC name is (4Z)-2-(3-methylphenyl)-4-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(3-methylphenyl)-4-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 5399584 |
| Molecular Formula | C18H12F3NO2 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (4Z)-2-(3-methylphenyl)-4-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | Cc1cccc(C2=N/C(=C\c3cccc(C(F)(F)F)c3)C(=O)O2)c1 |
| InChI | InChI=1S/C18H12F3NO2/c1-11-4-2-6-13(8-11)16-22-15(17(23)24-16)10-12-5-3-7-14(9-12)18(19,20)21/h2-10H,1H3/b15-10- |
| InChIKey | YAUDWZOHGBBSFE-GDNBJRDFSA-N |
| XLogP | 4.36 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|