C20H16N2O4 — CID 5399606
(4Z)-2-(4-methyl-3-nitrophenyl)-4-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-oxazol-5-one (PubChem CID 5399606) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is (4Z)-2-(4-methyl-3-nitrophenyl)-4-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(4-methyl-3-nitrophenyl)-4-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 5399606 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (4Z)-2-(4-methyl-3-nitrophenyl)-4-[(E)-2-methyl-3-phenylprop-2-enylidene]-1,3-oxazol-5-one |
| SMILES | CC(/C=C1\N=C(c2ccc(C)c([N+](=O)[O-])c2)OC1=O)=C\c1ccccc1 |
| InChI | InChI=1S/C20H16N2O4/c1-13(10-15-6-4-3-5-7-15)11-17-20(23)26-19(21-17)16-9-8-14(2)18(12-16)22(24)25/h3-12H,1-2H3/b13-10+,17-11- |
| InChIKey | SGTLECOZTMIKBU-NEOBQEPSSA-N |
| XLogP | 4.19 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|