C15H15N5O3 — CID 5399697
N-[(Z)-(3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 5399697) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is N-[(Z)-(3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[(Z)-(3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 5399697 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[(Z)-(3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | O=C(N/N=C\c1cccc([N+](=O)[O-])c1)c1n[nH]c2c1CCCC2 |
| InChI | InChI=1S/C15H15N5O3/c21-15(14-12-6-1-2-7-13(12)17-18-14)19-16-9-10-4-3-5-11(8-10)20(22)23/h3-5,8-9H,1-2,6-7H2,(H,17,18)(H,19,21)/b16-9- |
| InChIKey | VNIXCUDZYLMTEZ-SXGWCWSVSA-N |
| XLogP | 1.96 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|