About O-propan-2-yl ethylsulfanylmethanethioate
O-propan-2-yl ethylsulfanylmethanethioate (PubChem CID 539987) has the molecular formula C6H12OS2
and a molecular weight of 164.29 g/mol. Its IUPAC name is O-propan-2-yl ethylsulfanylmethanethioate.
Molecular Properties
| Compound Name | O-propan-2-yl ethylsulfanylmethanethioate |
| PubChem CID | 539987 |
| Molecular Formula | C6H12OS2 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | O-propan-2-yl ethylsulfanylmethanethioate |
| SMILES | CCSC(=S)OC(C)C |
| InChI | InChI=1S/C6H12OS2/c1-4-9-6(8)7-5(2)3/h5H,4H2,1-3H3 |
| InChIKey | FZWPRGCPLDOYAA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-propan-2-yl ethylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-propan-2-yl ethylsulfanylmethanethioate?
The IUPAC name of O-propan-2-yl ethylsulfanylmethanethioate (CID 539987) is O-propan-2-yl ethylsulfanylmethanethioate.
What is the SMILES notation for O-propan-2-yl ethylsulfanylmethanethioate?
The canonical SMILES for O-propan-2-yl ethylsulfanylmethanethioate is CCSC(=S)OC(C)C.
What is the InChIKey of O-propan-2-yl ethylsulfanylmethanethioate?
The InChIKey is FZWPRGCPLDOYAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12OS2/c1-4-9-6(8)7-5(2)3/h5H,4H2,1-3H3.
What are the key properties of O-propan-2-yl ethylsulfanylmethanethioate?
O-propan-2-yl ethylsulfanylmethanethioate has a molecular weight of 164.29 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-propan-2-yl ethylsulfanylmethanethioate is sourced from PubChem (CID 539987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).