C15H11NO2 — CID 54000776
(1Z)-9,10-dioxa-8-azatricyclo[12.4.0.02,7]octadeca-1,3,5,7,11,13,15,17-octaene (PubChem CID 54000776) has the molecular formula C15H11NO2 and a molecular weight of 237.26 g/mol. Its IUPAC name is (1Z)-9,10-dioxa-8-azatricyclo[12.4.0.02,7]octadeca-1,3,5,7,11,13,15,17-octaene.
| Compound Name | (1Z)-9,10-dioxa-8-azatricyclo[12.4.0.02,7]octadeca-1,3,5,7,11,13,15,17-octaene |
|---|---|
| PubChem CID | 54000776 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (1Z)-9,10-dioxa-8-azatricyclo[12.4.0.02,7]octadeca-1,3,5,7,11,13,15,17-octaene |
| SMILES | C1=COON=c2cccc/c2=c2\ccccc2=C1 |
| InChI | InChI=1S/C15H11NO2/c1-2-8-13-12(6-1)7-5-11-17-18-16-15-10-4-3-9-14(13)15/h1-11H/b11-5?,12-7?,14-13-,16-15? |
| InChIKey | KLKYFHAAYVOWMG-PMMHKTHWSA-N |
| XLogP | 1.76 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|