C36H47N3O5 — CID 54000975
[(5R)-5-[[(2R)-2-[(5-amino-5-methylhex-2-enoyl)-methylamino]-3-naphthalen-2-ylpropanoyl]-methylamino]-4-hydroxy-6-phenylhexyl] acetate (PubChem CID 54000975) has the molecular formula C36H47N3O5 and a molecular weight of 601.79 g/mol. Its IUPAC name is [(5R)-5-[[(2R)-2-[(5-amino-5-methylhex-2-enoyl)-methylamino]-3-naphthalen-2-ylpropanoyl]-methylamino]-4-hydroxy-6-phenylhexyl] acetate.
| Compound Name | [(5R)-5-[[(2R)-2-[(5-amino-5-methylhex-2-enoyl)-methylamino]-3-naphthalen-2-ylpropanoyl]-methylamino]-4-hydroxy-6-phenylhexyl] acetate |
|---|---|
| PubChem CID | 54000975 |
| Molecular Formula | C36H47N3O5 |
| Molecular Weight | 601.79 g/mol |
| Exact Mass | 601.35 |
| IUPAC Name | [(5R)-5-[[(2R)-2-[(5-amino-5-methylhex-2-enoyl)-methylamino]-3-naphthalen-2-ylpropanoyl]-methylamino]-4-hydroxy-6-phenylhexyl] acetate |
| SMILES | CC(=O)OCCCC(O)[C@@H](Cc1ccccc1)N(C)C(=O)[C@@H](Cc1ccc2ccccc2c1)N(C)C(=O)C=CCC(C)(C)N |
| InChI | InChI=1S/C36H47N3O5/c1-26(40)44-22-12-17-33(41)31(24-27-13-7-6-8-14-27)39(5)35(43)32(38(4)34(42)18-11-21-36(2,3)37)25-28-19-20-29-15-9-10-16-30(29)23-28/h6-11,13-16,18-20,23,31-33,41H,12,17,21-22,24-25,37H2,1-5H3/t31-,32-,33?/m1/s1 |
| InChIKey | KLOSGURBDNISDC-NWBPNMJXSA-N |
| XLogP | 4.67 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.79 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|