C25H37NO4 — CID 54001137
(2S)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-hydroxypropanoic acid (PubChem CID 54001137) has the molecular formula C25H37NO4 and a molecular weight of 415.57 g/mol. Its IUPAC name is (2S)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 54001137 |
| Molecular Formula | C25H37NO4 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | (2S)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-hydroxypropanoic acid |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C25H37NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24(28)26-23(22-27)25(29)30/h10-21,23,27H,2-9,22H2,1H3,(H,26,28)(H,29,30)/t23-/m0/s1 |
| InChIKey | KLRPGCWRBUEBPX-QHCPKHFHSA-N |
| XLogP | 5.03 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|