C17H13N3O — CID 54001251
8-(pyridin-4-ylmethyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ol (PubChem CID 54001251) has the molecular formula C17H13N3O and a molecular weight of 275.31 g/mol. Its IUPAC name is 8-(pyridin-4-ylmethyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ol.
| Compound Name | 8-(pyridin-4-ylmethyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ol |
|---|---|
| PubChem CID | 54001251 |
| Molecular Formula | C17H13N3O |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 8-(pyridin-4-ylmethyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ol |
| SMILES | OC1(Cc2ccncc2)c2cccnc2-c2ncccc21 |
| InChI | InChI=1S/C17H13N3O/c21-17(11-12-5-9-18-10-6-12)13-3-1-7-19-15(13)16-14(17)4-2-8-20-16/h1-10,21H,11H2 |
| InChIKey | KLTYMPCIRHHULR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |